CymitQuimica logo

CAS 866131-97-7

:

1-[(2,5-Dimethylphenyl)methyl]-N-ethyl-1H-benzimidazol-2-amine

Description:
1-[(2,5-Dimethylphenyl)methyl]-N-ethyl-1H-benzimidazol-2-amine is a chemical compound characterized by its complex structure, which includes a benzimidazole core substituted with an ethyl group and a 2,5-dimethylphenylmethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the benzimidazole moiety, which is known for its role in various pharmacological applications. The presence of the dimethylphenyl group may enhance lipophilicity, influencing its solubility and permeability in biological systems. Additionally, the compound may exhibit specific reactivity patterns typical of amines and benzimidazoles, such as hydrogen bonding and potential interactions with biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies on its pharmacodynamics, toxicity, and specific applications would be necessary to fully understand its characteristics and potential uses in various fields.
Formula:C18H21N3
InChI:InChI=1S/C18H21N3/c1-4-19-18-20-16-7-5-6-8-17(16)21(18)12-15-11-13(2)9-10-14(15)3/h5-11H,4,12H2,1-3H3,(H,19,20)
InChI key:InChIKey=OAKVYPOHIYBJBM-UHFFFAOYSA-N
SMILES:C(N1C=2C(N=C1NCC)=CC=CC2)C3=C(C)C=CC(C)=C3
Synonyms:
  • 1-[(2,5-Dimethylphenyl)methyl]-N-ethyl-1H-benzimidazol-2-amine
  • 1H-Benzimidazol-2-amine, 1-[(2,5-dimethylphenyl)methyl]-N-ethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.