
CAS 866131-99-9
:1-[[4-(1,1-Dimethylethyl)phenyl]methyl]-N-ethyl-1H-benzimidazol-2-amine
Description:
1-[[4-(1,1-Dimethylethyl)phenyl]methyl]-N-ethyl-1H-benzimidazol-2-amine, with CAS number 866131-99-9, is a chemical compound that belongs to the class of benzimidazole derivatives. This substance typically exhibits characteristics such as a complex molecular structure featuring a benzimidazole core, which is known for its diverse biological activities. The presence of a tert-butyl group and an ethyl substituent contributes to its lipophilicity, potentially influencing its solubility and permeability in biological systems. The compound may exhibit properties such as moderate to high stability under standard conditions, and it may interact with various biological targets, making it of interest in pharmaceutical research. Its specific applications and efficacy would depend on further studies, including pharmacokinetics and toxicity assessments. Overall, this compound exemplifies the structural diversity and potential utility of benzimidazole derivatives in medicinal chemistry.
Formula:C20H25N3
InChI:InChI=1S/C20H25N3/c1-5-21-19-22-17-8-6-7-9-18(17)23(19)14-15-10-12-16(13-11-15)20(2,3)4/h6-13H,5,14H2,1-4H3,(H,21,22)
InChI key:InChIKey=UTSCHBVVSZGJLX-UHFFFAOYSA-N
SMILES:C(N1C=2C(N=C1NCC)=CC=CC2)C3=CC=C(C(C)(C)C)C=C3
Synonyms:- 1-[[4-(1,1-Dimethylethyl)phenyl]methyl]-N-ethyl-1H-benzimidazol-2-amine
- 1H-Benzimidazol-2-amine, 1-[[4-(1,1-dimethylethyl)phenyl]methyl]-N-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.