
CAS 866133-57-5
:Ethyl 2-(2,5-dihydro-3-methyl-5-oxo-1H-pyrazol-1-yl)-3,4-dihydro-4-oxo-5-pyrimidinecarboxylate
Description:
Ethyl 2-(2,5-dihydro-3-methyl-5-oxo-1H-pyrazol-1-yl)-3,4-dihydro-4-oxo-5-pyrimidinecarboxylate, identified by its CAS number 866133-57-5, is a chemical compound characterized by its complex structure, which includes both pyrazole and pyrimidine moieties. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, which may include antimicrobial or anti-inflammatory effects, although specific biological data would need to be referenced for precise activities. The presence of ester functional groups suggests it may be soluble in organic solvents and could participate in various chemical reactions, including hydrolysis and esterification. Its molecular structure indicates that it may have a moderate to high molecular weight, influencing its physical properties like melting point and boiling point. Additionally, the compound's unique arrangement of functional groups may contribute to its reactivity and stability under different conditions. As with many synthetic organic compounds, safety data and handling precautions should be consulted before use in any application.
Formula:C11H12N4O4
InChI:InChI=1S/C11H12N4O4/c1-3-19-10(18)7-5-12-11(13-9(7)17)15-8(16)4-6(2)14-15/h4-5,14H,3H2,1-2H3,(H,12,13,17)
InChI key:InChIKey=UAAWALRVKREGDG-UHFFFAOYSA-N
SMILES:O=C1N(C=2NC(=O)C(C(OCC)=O)=CN2)NC(C)=C1
Synonyms:- 5-Pyrimidinecarboxylic acid, 2-(2,5-dihydro-3-methyl-5-oxo-1H-pyrazol-1-yl)-3,4-dihydro-4-oxo-, ethyl ester
- 5-Pyrimidinecarboxylic acid, 2-(2,5-dihydro-3-methyl-5-oxo-1H-pyrazol-1-yl)-1,4-dihydro-4-oxo-, ethyl ester
- Ethyl 2-(2,5-dihydro-3-methyl-5-oxo-1H-pyrazol-1-yl)-3,4-dihydro-4-oxo-5-pyrimidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.