CAS 866134-02-3

3-Amino-4-hydroxy-1-(3-nitrophenyl)-2-buten-1-one

Description:

3-Amino-4-hydroxy-1-(3-nitrophenyl)-2-buten-1-one, identified by its CAS number 866134-02-3, is an organic compound characterized by its unique functional groups, including an amino group, a hydroxyl group, and a nitrophenyl moiety. This compound typically exhibits a yellow to orange color due to the presence of the nitro group, which can also influence its reactivity and solubility in various solvents. It is likely to be soluble in polar solvents due to the hydroxyl and amino groups, which can engage in hydrogen bonding. The presence of the conjugated double bond system in the butenone structure may impart certain electronic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and electrophilic additions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including pH, temperature, and the presence of other reagents.

Formula: C₁₀H₁₀N₂O₄

InChI: InChI=1S/C10H10N2O4/c11-8(6-13)5-10(14)7-2-1-3-9(4-7)12(15)16/h1-5,13H,6,11H2

InChI key: InChIKey=NMXBEUNMEDYPJX-UHFFFAOYSA-N

SMILES: C(C=C(CO)N)(=O)C1=CC(N(=O)=O)=CC=C1

Synonyms:

• 3-Amino-4-hydroxy-1-(3-nitrophenyl)-2-buten-1-one
• 2-Buten-1-one, 3-amino-4-hydroxy-1-(3-nitrophenyl)-