CymitQuimica logo

CAS 866134-72-7

:

1-(Phenylmethyl)-4-piperidinecarboxylic acid 2-[[(2-methoxyphenyl)amino]thioxomethyl]hydrazide

Description:
1-(Phenylmethyl)-4-piperidinecarboxylic acid 2-[[(2-methoxyphenyl)amino]thioxomethyl]hydrazide, with the CAS number 866134-72-7, is a complex organic compound characterized by its unique structural features. It contains a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and a phenylmethyl group that contributes to its aromatic properties. The presence of a carboxylic acid functional group indicates potential acidity and reactivity, while the hydrazide moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The methoxyphenyl group adds to its lipophilicity and may influence its pharmacokinetic properties. This compound may exhibit various biological activities, potentially acting as an inhibitor or modulator in biochemical pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods like crystallization or chromatography. Overall, the compound's intricate structure and functional groups suggest a diverse range of potential applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and effects.
Formula:C21H26N4O2S
InChI:InChI=1S/C21H26N4O2S/c1-27-19-10-6-5-9-18(19)22-21(28)24-23-20(26)17-11-13-25(14-12-17)15-16-7-3-2-4-8-16/h2-10,17H,11-15H2,1H3,(H,23,26)(H2,22,24,28)
InChI key:InChIKey=AQJYZQNFEDANDC-UHFFFAOYSA-N
SMILES:N(C(NNC(=O)C1CCN(CC2=CC=CC=C2)CC1)=S)C3=C(OC)C=CC=C3
Synonyms:
  • 4-Piperidinecarboxylic acid, 1-(phenylmethyl)-, 2-[[(2-methoxyphenyl)amino]thioxomethyl]hydrazide
  • 1-(Phenylmethyl)-4-piperidinecarboxylic acid 2-[[(2-methoxyphenyl)amino]thioxomethyl]hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.