CAS 866134-74-9

1-(Phenylmethyl)-4-piperidinecarboxylic acid 2-[(ethylamino)thioxomethyl]hydrazide

Description:

1-(Phenylmethyl)-4-piperidinecarboxylic acid 2-[(ethylamino)thioxomethyl]hydrazide, with CAS number 866134-74-9, is a chemical compound that features a complex structure incorporating a piperidine ring, a phenylmethyl group, and a hydrazide moiety. This compound is characterized by its potential biological activity, which may include interactions with various biological targets due to the presence of functional groups such as the hydrazide and thioxomethyl. The piperidine ring contributes to its cyclic structure, which can influence its pharmacokinetic properties, including solubility and permeability. The ethylamino group may enhance its reactivity and interaction with biological systems. As with many compounds of this nature, its specific applications could range from medicinal chemistry to research in pharmacology, depending on its efficacy and safety profile. However, detailed studies would be necessary to fully elucidate its properties, mechanisms of action, and potential therapeutic uses.

Formula: C₁₆H₂₄N₄OS

InChI: InChI=1S/C16H24N4OS/c1-2-17-16(22)19-18-15(21)14-8-10-20(11-9-14)12-13-6-4-3-5-7-13/h3-7,14H,2,8-12H2,1H3,(H,18,21)(H2,17,19,22)

InChI key: InChIKey=WAWWCVNYBJNRAU-UHFFFAOYSA-N

SMILES: C(NNC(NCC)=S)(=O)C1CCN(CC2=CC=CC=C2)CC1

Synonyms:

• 4-Piperidinecarboxylic acid, 1-(phenylmethyl)-, 2-[(ethylamino)thioxomethyl]hydrazide
• 1-(Phenylmethyl)-4-piperidinecarboxylic acid 2-[(ethylamino)thioxomethyl]hydrazide