CAS 866135-05-9
:4-(2,6-Dimethylphenyl)-α-(trifluoromethyl)-1-piperazineethanol
Description:
4-(2,6-Dimethylphenyl)-α-(trifluoromethyl)-1-piperazineethanol, identified by its CAS number 866135-05-9, is a chemical compound characterized by its piperazine structure, which is a six-membered ring containing two nitrogen atoms. This compound features a trifluoromethyl group, which enhances its lipophilicity and may influence its biological activity. The presence of the 2,6-dimethylphenyl group contributes to its hydrophobic characteristics and can affect its interaction with biological targets. The hydroxyl group in the ethanol moiety can participate in hydrogen bonding, potentially influencing solubility and reactivity. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its unique structural features suggest potential applications in various fields, including drug design and synthesis. However, specific biological activities, toxicity, and environmental impact would require further investigation through empirical studies.
Formula:C15H21F3N2O
InChI:InChI=1S/C15H21F3N2O/c1-11-4-3-5-12(2)14(11)20-8-6-19(7-9-20)10-13(21)15(16,17)18/h3-5,13,21H,6-10H2,1-2H3
InChI key:InChIKey=VWYXTBSYLBLTRM-UHFFFAOYSA-N
SMILES:CC1=C(C(C)=CC=C1)N2CCN(CC(C(F)(F)F)O)CC2
Synonyms:- 4-(2,6-Dimethylphenyl)-α-(trifluoromethyl)-1-piperazineethanol
- 1-Piperazineethanol, 4-(2,6-dimethylphenyl)-α-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.