CymitQuimica logo

CAS 866135-66-2

:

3-Bromo-8-methylimidazo[1,2-a]pyridine

Description:
3-Bromo-8-methylimidazo[1,2-a]pyridine is a heterocyclic aromatic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features a bromine atom at the 3-position and a methyl group at the 8-position of the imidazo ring, influencing its reactivity and potential biological activity. It is known for its role as a mutagen and potential carcinogen, particularly in the context of cooked meats, where it can form during the cooking process of amino acids and creatine at high temperatures. The presence of the bromine atom enhances its electrophilic character, making it more reactive in various chemical reactions. Additionally, 3-Bromo-8-methylimidazo[1,2-a]pyridine is of interest in research related to cancer biology and toxicology due to its structural similarity to other known carcinogens. Its solubility and stability in different solvents can vary, affecting its behavior in biological systems and environmental contexts. Overall, this compound serves as a significant subject of study in both organic chemistry and health sciences.
Formula:C8H7BrN2
InChI:InChI=1S/C8H7BrN2/c1-6-3-2-4-11-7(9)5-10-8(6)11/h2-5H,1H3
InChI key:InChIKey=LPEITAUQQRNUAI-UHFFFAOYSA-N
SMILES:CC=1C=2N(C(Br)=CN2)C=CC1
Synonyms:
  • 3-Bromo-8-methylimidazo[1,2-a]pyridine
  • Imidazo[1,2-a]pyridine, 3-bromo-8-methyl-
Found 3 products.