CymitQuimica logo

CAS 866135-67-3

:

1-(4-Bromo-5-fluoro-2-nitrophenyl)-4-methylpiperazine

Description:
1-(4-Bromo-5-fluoro-2-nitrophenyl)-4-methylpiperazine is a chemical compound characterized by its complex structure, which includes a piperazine ring substituted with a phenyl group that carries multiple halogen and nitro substituents. The presence of a bromine atom, a fluorine atom, and a nitro group on the phenyl ring contributes to its unique reactivity and potential biological activity. The piperazine moiety is known for its role in various pharmacological applications, often serving as a scaffold in drug design. This compound may exhibit properties such as lipophilicity and potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-withdrawing nature of the nitro group and the halogens. Additionally, the compound's stability, solubility, and reactivity can be influenced by the specific arrangement of its substituents, which may affect its application in research and development.
Formula:C11H13BrFN3O2
InChI:InChI=1S/C11H13BrFN3O2/c1-14-2-4-15(5-3-14)10-7-9(13)8(12)6-11(10)16(17)18/h6-7H,2-5H2,1H3
InChI key:InChIKey=MPGYSAJHWBDYJE-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C=C(F)C(Br)=C1)N2CCN(C)CC2
Synonyms:
  • Piperazine, 1-(4-bromo-5-fluoro-2-nitrophenyl)-4-methyl-
  • 1-(4-Bromo-5-fluoro-2-nitrophenyl)-4-methylpiperazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.