CAS 866135-72-0

4-Thiomorpholinepropanol, γ-(2-fluorophenyl)-, 1,1-dioxide

Description:

4-Thiomorpholinepropanol, γ-(2-fluorophenyl)-, 1,1-dioxide, identified by its CAS number 866135-72-0, is a chemical compound that features a thiomorpholine ring, which is a six-membered heterocyclic structure containing sulfur and nitrogen. This compound is characterized by the presence of a fluorophenyl group, which can influence its chemical reactivity and biological activity due to the electronegative fluorine atom. The 1,1-dioxide functional group indicates the presence of two double-bonded oxygen atoms, which can enhance the compound's polarity and solubility in polar solvents. The thiomorpholine moiety contributes to its potential as a pharmacophore in medicinal chemistry, possibly exhibiting various biological activities. The compound's structure suggests it may participate in hydrogen bonding and other intermolecular interactions, making it of interest in drug design and development. Overall, its unique combination of functional groups and heteroatoms positions it as a potentially valuable compound in various chemical and pharmaceutical applications.

Formula: C₁₃H₁₈FNO₃S

InChI: InChI=1S/C13H18FNO3S/c14-12-4-2-1-3-11(12)13(5-8-16)15-6-9-19(17,18)10-7-15/h1-4,13,16H,5-10H2

InChI key: InChIKey=STACABYABMCGAS-UHFFFAOYSA-N

SMILES: C(CCO)(C1=C(F)C=CC=C1)N2CCS(=O)(=O)CC2

Synonyms:

• 4-Thiomorpholinepropanol, γ-(2-fluorophenyl)-, 1,1-dioxide
• 4-[1-(2-FLUOROPHENYL)-3-HYDROXYPROPYL]-1LAMBDA6,4-THIAZINANE-1,1-DIONE