CymitQuimica logo

CAS 866135-79-7

:

1-[1-(3,4-Dichlorophenyl)-1H-1,2,3-triazol-4-yl]ethanone

Description:
1-[1-(3,4-Dichlorophenyl)-1H-1,2,3-triazol-4-yl]ethanone, with the CAS number 866135-79-7, is a chemical compound characterized by its unique triazole structure, which is a five-membered ring containing three nitrogen atoms. This compound features a dichlorophenyl group, indicating the presence of two chlorine atoms on a phenyl ring, which contributes to its biological activity and lipophilicity. The ethanone moiety suggests that it has a ketone functional group, which can participate in various chemical reactions, including nucleophilic attacks. The presence of the triazole ring often imparts significant pharmacological properties, making such compounds of interest in medicinal chemistry, particularly in the development of antifungal and antibacterial agents. Additionally, the dichlorophenyl substituent may enhance the compound's ability to interact with biological targets. Overall, this compound's structural features suggest potential applications in pharmaceuticals, but its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups.
Formula:C10H7Cl2N3O
InChI:InChI=1S/C10H7Cl2N3O/c1-6(16)10-5-15(14-13-10)7-2-3-8(11)9(12)4-7/h2-5H,1H3
InChI key:InChIKey=BUQBFDFIHMHBJX-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=CN(N=N1)C2=CC(Cl)=C(Cl)C=C2
Synonyms:
  • Ethanone, 1-[1-(3,4-dichlorophenyl)-1H-1,2,3-triazol-4-yl]-
  • 1-[1-(3,4-Dichlorophenyl)-1H-1,2,3-triazol-4-yl]ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.