CymitQuimica logo

CAS 866135-84-4

:

6-Bromo-8-methylimidazo[1,2-a]pyridine-2-carboxylic acid hydrazide

Description:
6-Bromo-8-methylimidazo[1,2-a]pyridine-2-carboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes a brominated imidazo-pyridine core and a hydrazide functional group. This compound is typically recognized for its potential biological activity, particularly in the context of medicinal chemistry and pharmacology. The presence of the bromine atom may influence its reactivity and interaction with biological targets, while the hydrazide moiety can participate in various chemical reactions, including hydrazone formation and potential interactions with enzymes. Its molecular structure suggests it may exhibit properties relevant to drug development, particularly in targeting specific pathways or receptors. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. As with many chemical substances, safety and handling precautions are essential, given the potential for biological activity and the presence of halogenated compounds, which may pose environmental and health risks.
Formula:C9H9BrN4O
InChI:InChI=1S/C9H9BrN4O/c1-5-2-6(10)3-14-4-7(9(15)13-11)12-8(5)14/h2-4H,11H2,1H3,(H,13,15)
InChI key:InChIKey=CWRXHRUXYCZKBV-UHFFFAOYSA-N
SMILES:CC=1C=2N(C=C(C(NN)=O)N2)C=C(Br)C1
Synonyms:
  • 6-Bromo-8-methylimidazo[1,2-a]pyridine-2-carboxylic acid hydrazide
  • Imidazo[1,2-a]pyridine-2-carboxylic acid, 6-bromo-8-methyl-, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.