
CAS 866136-77-8
:6-[(4-Ethyl-4,5-dihydro-5-thioxo-1H-1,2,4-triazol-3-yl)methoxy]-2-phenyl-3(2H)-pyridazinone
Description:
The chemical substance known as 6-[(4-Ethyl-4,5-dihydro-5-thioxo-1H-1,2,4-triazol-3-yl)methoxy]-2-phenyl-3(2H)-pyridazinone, with the CAS number 866136-77-8, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyridazinone core and a triazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. Its thioxo group may contribute to its reactivity and interactions with biological targets. The presence of ethyl and phenyl groups suggests that it may have lipophilic characteristics, which can influence its pharmacokinetics and bioavailability. Additionally, the compound's structure indicates potential for various chemical modifications, which could enhance its therapeutic efficacy or selectivity. Overall, this substance represents a class of compounds that may have applications in medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C15H15N5O2S
InChI:InChI=1S/C15H15N5O2S/c1-2-19-12(16-17-15(19)23)10-22-13-8-9-14(21)20(18-13)11-6-4-3-5-7-11/h3-9H,2,10H2,1H3,(H,17,23)
InChI key:InChIKey=TWTUWKBNPUWORE-UHFFFAOYSA-N
SMILES:O=C1N(N=C(OCC=2N(CC)C(=S)NN2)C=C1)C3=CC=CC=C3
Synonyms:- 6-[(4-Ethyl-4,5-dihydro-5-thioxo-1H-1,2,4-triazol-3-yl)methoxy]-2-phenyl-3(2H)-pyridazinone
- 3(2H)-Pyridazinone, 6-[(4-ethyl-4,5-dihydro-5-thioxo-1H-1,2,4-triazol-3-yl)methoxy]-2-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.