CAS 866137-10-2
:3-bromo-5-chloro-2-(1H-pyrrol-1-yl)pyridine
Description:
3-Bromo-5-chloro-2-(1H-pyrrol-1-yl)pyridine is a heterocyclic organic compound characterized by its pyridine and pyrrole moieties. The presence of bromine and chlorine substituents on the pyridine ring enhances its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits a pale yellow to brown solid appearance and is soluble in organic solvents, reflecting its non-polar characteristics. Its molecular structure suggests potential biological activity, making it a candidate for research in pharmaceuticals, particularly in the development of new therapeutic agents. The bromine and chlorine atoms can influence the compound's electronic properties, potentially affecting its interaction with biological targets. Additionally, the presence of the pyrrole group may contribute to its ability to form hydrogen bonds, which is significant in biological systems. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-bromo-5-chloro-2-(1H-pyrrol-1-yl)pyridine is a compound of interest in various chemical research fields.
Formula:C9H6BrClN2
InChI:InChI=1/C9H6BrClN2/c10-8-5-7(11)6-12-9(8)13-3-1-2-4-13/h1-6H
SMILES:c1ccn(c1)c1c(cc(cn1)Cl)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
