CymitQuimica logo

CAS 866137-43-1

:

1-[(3-Chlorophenyl)methyl]-N-ethyl-1H-benzimidazol-2-amine

Description:
1-[(3-Chlorophenyl)methyl]-N-ethyl-1H-benzimidazol-2-amine is a chemical compound characterized by its complex structure, which includes a benzimidazole core substituted with an ethyl group and a 3-chlorobenzyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the benzimidazole ring, which is known for its role in various pharmacological applications. The chlorine atom on the phenyl ring can influence the compound's reactivity and solubility, potentially enhancing its lipophilicity. The presence of the amine group suggests that it may engage in hydrogen bonding, affecting its interaction with biological targets. Additionally, this compound may exhibit moderate to high stability under standard conditions, but its specific reactivity and solubility characteristics would depend on the solvent and environmental conditions. Overall, 1-[(3-Chlorophenyl)methyl]-N-ethyl-1H-benzimidazol-2-amine is of interest in medicinal chemistry, particularly for its potential therapeutic applications.
Formula:C16H16ClN3
InChI:InChI=1S/C16H16ClN3/c1-2-18-16-19-14-8-3-4-9-15(14)20(16)11-12-6-5-7-13(17)10-12/h3-10H,2,11H2,1H3,(H,18,19)
InChI key:InChIKey=OBTRBIFPSAPEMN-UHFFFAOYSA-N
SMILES:C(N1C=2C(N=C1NCC)=CC=CC2)C3=CC(Cl)=CC=C3
Synonyms:
  • 1-[(3-Chlorophenyl)methyl]-N-ethyl-1H-1,3-benzodiazol-2-amine
  • 1-[(3-Chlorophenyl)methyl]-N-ethyl-1H-benzimidazol-2-amine
  • 1H-Benzimidazol-2-amine, 1-[(3-chlorophenyl)methyl]-N-ethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.