CymitQuimica logo

CAS 866137-46-4

:

1,2,3,4,5,6-Hexahydro-1,3-dimethyl-2,4,5-trioxofuro[2,3-d]pyrimidine-6-carboxaldehyde 6-[O-[(2,4-dichlorophenyl)methyl]oxime]

Description:
1,2,3,4,5,6-Hexahydro-1,3-dimethyl-2,4,5-trioxofuro[2,3-d]pyrimidine-6-carboxaldehyde 6-[O-[(2,4-dichlorophenyl)methyl]oxime] is a complex organic compound characterized by its unique structural features, including a fused pyrimidine and furo[2,3-d] ring system. This compound contains multiple functional groups, such as aldehyde and oxime, which contribute to its reactivity and potential applications in medicinal chemistry. The presence of the dichlorophenyl moiety suggests possible interactions with biological targets, making it of interest in drug development. Its hexahydro structure indicates saturation, which may influence its physical properties, such as solubility and stability. The compound's molecular architecture suggests potential for diverse chemical reactivity, including nucleophilic addition and condensation reactions. As with many complex organic molecules, its synthesis and characterization would require careful analytical techniques, such as NMR and mass spectrometry, to confirm its identity and purity. Overall, this compound exemplifies the intricate nature of synthetic organic chemistry and its relevance in pharmaceutical research.
Formula:C16H13Cl2N3O5
InChI:InChI=1S/C16H13Cl2N3O5/c1-20-14(23)12-13(22)11(26-15(12)21(2)16(20)24)6-19-25-7-8-3-4-9(17)5-10(8)18/h3-6,11H,7H2,1-2H3
InChI key:InChIKey=SYBKLWHLMMBUGO-UHFFFAOYSA-N
SMILES:CN1C2=C(C(=O)C(C=NOCC3=C(Cl)C=C(Cl)C=C3)O2)C(=O)N(C)C1=O
Synonyms:
  • Furo[2,3-d]pyrimidine-6-carboxaldehyde, 1,2,3,4,5,6-hexahydro-1,3-dimethyl-2,4,5-trioxo-, 6-[O-[(2,4-dichlorophenyl)methyl]oxime]
  • 1,2,3,4,5,6-Hexahydro-1,3-dimethyl-2,4,5-trioxofuro[2,3-d]pyrimidine-6-carboxaldehyde 6-[O-[(2,4-dichlorophenyl)methyl]oxime]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.