
CAS 866137-83-9
:2-[1,6-Dihydro-6-oxo-4-(trifluoromethyl)-2-pyrimidinyl]-1,2,4,5,6,7-hexahydro-3H-indazol-3-one
Description:
The chemical substance known as 2-[1,6-Dihydro-6-oxo-4-(trifluoromethyl)-2-pyrimidinyl]-1,2,4,5,6,7-hexahydro-3H-indazol-3-one, with the CAS number 866137-83-9, is a complex organic compound characterized by its unique structural features. It contains a pyrimidine ring fused with a hexahydro-indazole moiety, which contributes to its potential biological activity. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound is likely to exhibit properties typical of heterocyclic compounds, such as varied solubility in organic solvents and potential reactivity due to the presence of functional groups. Its specific applications may include roles in medicinal chemistry, particularly in the development of pharmaceuticals, where such structures are often explored for their therapeutic effects. The compound's stability, reactivity, and biological activity would depend on its precise molecular interactions, which can be influenced by environmental factors and the presence of other chemical species.
Formula:C12H11F3N4O2
InChI:InChI=1S/C12H11F3N4O2/c13-12(14,15)8-5-9(20)17-11(16-8)19-10(21)6-3-1-2-4-7(6)18-19/h5,18H,1-4H2,(H,16,17,20)
InChI key:InChIKey=RGAKQYIMJQDJSU-UHFFFAOYSA-N
SMILES:O=C1N(NC2=C1CCCC2)C=3NC(C(F)(F)F)=CC(=O)N3
Synonyms:- 3H-Indazol-3-one, 2-[1,4-dihydro-4-oxo-6-(trifluoromethyl)-2-pyrimidinyl]-1,2,4,5,6,7-hexahydro-
- 3H-Indazol-3-one, 2-[1,6-dihydro-6-oxo-4-(trifluoromethyl)-2-pyrimidinyl]-1,2,4,5,6,7-hexahydro-
- 2-[1,6-Dihydro-6-oxo-4-(trifluoromethyl)-2-pyrimidinyl]-1,2,4,5,6,7-hexahydro-3H-indazol-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.