CAS 866137-93-1

Imidazo[1,2-a]pyridine-6-carboxylic acid, 2-(3-aminophenyl)-, methyl ester

Description:

Imidazo[1,2-a]pyridine-6-carboxylic acid, 2-(3-aminophenyl)-, methyl ester is a chemical compound characterized by its imidazo-pyridine core structure, which is a bicyclic compound featuring both imidazole and pyridine rings. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the amino group and carboxylic acid functionality. The methyl ester group suggests that it may have enhanced lipophilicity, which can influence its solubility and permeability in biological systems. The presence of the 3-aminophenyl substituent may contribute to its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. Additionally, compounds of this nature are often investigated for their potential pharmacological properties, including anti-inflammatory, antimicrobial, or anticancer activities. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the molecular interactions and the environment in which the compound is studied.

Formula: C₁₅H₁₃N₃O₂

InChI: InChI=1S/C15H13N3O2/c1-20-15(19)11-5-6-14-17-13(9-18(14)8-11)10-3-2-4-12(16)7-10/h2-9H,16H2,1H3

InChI key: InChIKey=NPXMRZXPVGXVFP-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CN2C(=NC(=C2)C3=CC(N)=CC=C3)C=C1

Synonyms:

• Imidazo[1,2-a]pyridine-6-carboxylic acid, 2-(3-aminophenyl)-, methyl ester