CAS 866138-29-6

1,3-Benzodioxole-5-carboxylic acid, 2-[(4-fluorophenyl)sulfonyl]hydrazide

Description:

1,3-Benzodioxole-5-carboxylic acid, 2-[(4-fluorophenyl)sulfonyl]hydrazide is a chemical compound characterized by its complex structure, which includes a benzodioxole moiety and a hydrazide functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and biological activity. The presence of the sulfonyl group linked to a fluorophenyl ring suggests that it may possess unique electronic properties, potentially influencing its solubility and interaction with biological targets. The carboxylic acid group can participate in hydrogen bonding and may enhance the compound's solubility in polar solvents. Additionally, the fluorine atom in the para position of the phenyl ring can affect the compound's lipophilicity and metabolic stability. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly for its potential pharmacological applications, although specific biological activities would require further investigation.

Formula: C₁₄H₁₁FN₂O₅S

InChI: InChI=1S/C14H11FN2O5S/c15-10-2-4-11(5-3-10)23(19,20)17-16-14(18)9-1-6-12-13(7-9)22-8-21-12/h1-7,17H,8H2,(H,16,18)

InChI key: InChIKey=DENRELHJMLIKEQ-UHFFFAOYSA-N

SMILES: C(NNS(=O)(=O)C1=CC=C(F)C=C1)(=O)C=2C=C3C(=CC2)OCO3

Synonyms:

• 1,3-Benzodioxole-5-carboxylic acid, 2-[(4-fluorophenyl)sulfonyl]hydrazide