CymitQuimica logo

CAS 866138-52-5

:

9-(2-Bromophenyl)-6,9-dihydro-1,3-dioxolo[4,5-g]furo[3,4-b]quinolin-8(5H)-one

Description:
9-(2-Bromophenyl)-6,9-dihydro-1,3-dioxolo[4,5-g]furo[3,4-b]quinolin-8(5H)-one, with the CAS number 866138-52-5, is a complex organic compound characterized by its unique fused ring structure, which includes a quinoline core and a dioxole moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, including antimicrobial or anticancer effects, due to the presence of the bromophenyl group and the quinoline framework. Its molecular structure suggests it may engage in various chemical interactions, making it of interest in medicinal chemistry and drug development. The presence of the dioxole ring contributes to its stability and may influence its solubility and reactivity. Additionally, the bromine substituent can enhance its electrophilic character, potentially facilitating further chemical modifications. Overall, this compound represents a class of heterocycles that are often investigated for their pharmacological properties and synthetic utility in organic chemistry.
Formula:C18H12BrNO4
InChI:InChI=1S/C18H12BrNO4/c19-11-4-2-1-3-9(11)16-10-5-14-15(24-8-23-14)6-12(10)20-13-7-22-18(21)17(13)16/h1-6,16,20H,7-8H2
InChI key:InChIKey=LMBQAFTUNFHSKJ-UHFFFAOYSA-N
SMILES:O=C1C=2C(C=3C(NC2CO1)=CC4=C(C3)OCO4)C5=C(Br)C=CC=C5
Synonyms:
  • 1,3-Dioxolo[4,5-g]furo[3,4-b]quinolin-8(5H)-one, 9-(2-bromophenyl)-6,9-dihydro-
  • 9-(2-Bromophenyl)-6,9-dihydro-1,3-dioxolo[4,5-g]furo[3,4-b]quinolin-8(5H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.