CAS 866142-45-2
:2-Amino-N,N,4,5-tetramethyl-3-(methylsulfonyl)-1H-pyrrole-1-propanamine
Description:
2-Amino-N,N,4,5-tetramethyl-3-(methylsulfonyl)-1H-pyrrole-1-propanamine, with CAS number 866142-45-2, is a synthetic organic compound characterized by its complex structure featuring a pyrrole ring substituted with multiple functional groups. This compound contains an amino group, which contributes to its basicity and potential reactivity in various chemical reactions. The presence of tetramethyl groups enhances its steric bulk, potentially influencing its solubility and interaction with biological systems. Additionally, the methylsulfonyl group introduces a sulfonyl moiety, which can enhance the compound's polarity and solubility in polar solvents. The overall molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique combination of functional groups that may interact with biological targets. Its stability, reactivity, and solubility characteristics would be essential for determining its practical applications and behavior in various chemical environments. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C12H23N3O2S
InChI:InChI=1S/C12H23N3O2S/c1-9-10(2)15(8-6-7-14(3)4)12(13)11(9)18(5,16)17/h6-8,13H2,1-5H3
InChI key:InChIKey=BJXVGXDZGIHFBE-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(N)N(CCCN(C)C)C(C)=C1C
Synonyms:- 2-Amino-N,N,4,5-tetramethyl-3-(methylsulfonyl)-1H-pyrrole-1-propanamine
- 1H-Pyrrole-1-propanamine, 2-amino-N,N,4,5-tetramethyl-3-(methylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.