CAS 866142-46-3
:N-(4-Chlorophenyl)-2-[1-[5-(cyanomethyl)-2-thienyl]ethylidene]hydrazinecarboxamide
Description:
N-(4-Chlorophenyl)-2-[1-[5-(cyanomethyl)-2-thienyl]ethylidene]hydrazinecarboxamide, with the CAS number 866142-46-3, is a synthetic organic compound characterized by its complex molecular structure, which includes a hydrazinecarboxamide moiety and a thienyl group. This compound features a 4-chlorophenyl substituent, contributing to its potential biological activity and lipophilicity. The presence of a cyanomethyl group enhances its reactivity, making it a candidate for various chemical transformations. The thienyl ring adds to the compound's aromatic character, which can influence its interaction with biological targets. Typically, compounds of this nature may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological data would be necessary to confirm these effects. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, this compound represents a class of hydrazine derivatives that may have significant applications in medicinal chemistry and drug development.
Formula:C15H13ClN4OS
InChI:InChI=1S/C15H13ClN4OS/c1-10(14-7-6-13(22-14)8-9-17)19-20-15(21)18-12-4-2-11(16)3-5-12/h2-7H,8H2,1H3,(H2,18,20,21)
InChI key:InChIKey=VYJZSLJGQHKWCO-UHFFFAOYSA-N
SMILES:C(=NNC(NC1=CC=C(Cl)C=C1)=O)(C)C=2SC(CC#N)=CC2
Synonyms:- Hydrazinecarboxamide, N-(4-chlorophenyl)-2-[1-[5-(cyanomethyl)-2-thienyl]ethylidene]-
- N-(4-Chlorophenyl)-2-[1-[5-(cyanomethyl)-2-thienyl]ethylidene]hydrazinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.