CAS 866142-88-3
:4-(2-Chloroacetyl)-1H-pyrrole-2-carboxaldehyde 2-[2-(2,4-dinitrophenyl)hydrazone]
Description:
4-(2-Chloroacetyl)-1H-pyrrole-2-carboxaldehyde 2-[2-(2,4-dinitrophenyl)hydrazone], with the CAS number 866142-88-3, is a chemical compound characterized by its complex structure, which includes a pyrrole ring and a hydrazone functional group. This compound typically exhibits properties associated with both the pyrrole and hydrazone moieties, such as potential reactivity due to the presence of electrophilic sites and the ability to form hydrogen bonds. The chloroacetyl group contributes to its reactivity, making it a candidate for various chemical transformations. The presence of the dinitrophenyl group may enhance its electronic properties, potentially influencing its behavior in biological systems or as a reagent in synthetic chemistry. This compound may also display specific solubility characteristics depending on the solvent used, and its stability can be affected by environmental conditions such as pH and temperature. Overall, this substance is of interest in fields such as medicinal chemistry and materials science due to its unique structural features and potential applications.
Formula:C13H10ClN5O5
InChI:InChI=1S/C13H10ClN5O5/c14-5-13(20)8-3-9(15-6-8)7-16-17-11-2-1-10(18(21)22)4-12(11)19(23)24/h1-4,6-7,15,17H,5H2
InChI key:InChIKey=DDWTUHATLIIVDQ-UHFFFAOYSA-N
SMILES:N(N=CC1=CC(C(CCl)=O)=CN1)C2=C(N(=O)=O)C=C(N(=O)=O)C=C2
Synonyms:- 1H-Pyrrole-2-carboxaldehyde, 4-(2-chloroacetyl)-, 2-[2-(2,4-dinitrophenyl)hydrazone]
- 1H-Pyrrole-2-carboxaldehyde, 4-(chloroacetyl)-, 2-[(2,4-dinitrophenyl)hydrazone]
- 4-(2-Chloroacetyl)-1H-pyrrole-2-carboxaldehyde 2-[2-(2,4-dinitrophenyl)hydrazone]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.