CAS 866143-74-0

6-Chloro-3-[(2,4-dichlorophenyl)methylene]-2,3-dihydro-4H-1-benzothiopyran-4-one

Description:

6-Chloro-3-[(2,4-dichlorophenyl)methylene]-2,3-dihydro-4H-1-benzothiopyran-4-one is a synthetic organic compound characterized by its complex structure, which includes a benzothiopyran core fused with a chlorinated phenyl group. This compound features a chloro substituent at the 6-position and a methylene bridge connecting to a dichlorophenyl moiety, contributing to its unique reactivity and potential biological activity. The presence of multiple chlorine atoms enhances its lipophilicity and may influence its interaction with biological targets. The benzothiopyran framework is known for its diverse pharmacological properties, including anti-inflammatory and antimicrobial activities. As a chemical entity, it may exhibit specific solubility characteristics, stability under various conditions, and potential for further derivatization. Its CAS number, 866143-74-0, allows for precise identification in chemical databases, facilitating research and development in medicinal chemistry and related fields. Overall, this compound represents a significant interest for further exploration in drug discovery and development due to its structural complexity and potential therapeutic applications.

Formula: C₁₆H₉Cl₃OS

InChI: InChI=1S/C16H9Cl3OS/c17-11-3-4-15-13(6-11)16(20)10(8-21-15)5-9-1-2-12(18)7-14(9)19/h1-7H,8H2

InChI key: InChIKey=LVWLCGIMPXUIMY-UHFFFAOYSA-N

SMILES: O=C1C=2C(SCC1=CC3=C(Cl)C=C(Cl)C=C3)=CC=C(Cl)C2

Synonyms:

• 6-Chloro-3-[(2,4-dichlorophenyl)methylene]-2,3-dihydro-4H-1-benzothiopyran-4-one
• 4H-1-Benzothiopyran-4-one, 6-chloro-3-[(2,4-dichlorophenyl)methylene]-2,3-dihydro-