CymitQuimica logo

CAS 866144-04-9

:

N-(4-Fluoro-1H-indazol-7-yl)thiourea

Description:
N-(4-Fluoro-1H-indazol-7-yl)thiourea is a chemical compound characterized by its unique structure, which includes an indazole moiety substituted with a fluorine atom and a thiourea functional group. This compound typically exhibits properties associated with both the indazole and thiourea functionalities, such as potential biological activity and the ability to form hydrogen bonds due to the presence of the thiourea group. The fluorine substitution can influence the compound's lipophilicity and reactivity, potentially enhancing its pharmacological properties. In terms of solubility, compounds of this nature may exhibit varying degrees of solubility in polar and non-polar solvents, depending on their specific structural features. Additionally, N-(4-Fluoro-1H-indazol-7-yl)thiourea may be of interest in medicinal chemistry for its potential applications in drug development, particularly in targeting specific biological pathways. As with many chemical substances, safety and handling precautions should be observed, given the potential toxicity associated with thiourea derivatives.
Formula:C8H7FN4S
InChI:InChI=1S/C8H7FN4S/c9-5-1-2-6(12-8(10)14)7-4(5)3-11-13-7/h1-3H,(H,11,13)(H3,10,12,14)
InChI key:InChIKey=HZTXGAZDCCPCBP-UHFFFAOYSA-N
SMILES:N(C(N)=S)C1=C2C(=C(F)C=C1)C=NN2
Synonyms:
  • Thiourea, (4-fluoro-1H-indazol-7-yl)-
  • Thiourea, N-(4-fluoro-1H-indazol-7-yl)-
  • N-(4-Fluoro-1H-indazol-7-yl)thiourea
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.