CAS 866144-12-9
:5-[(3-Fluoropropyl)thio]-1,3,4-thiadiazole-2(3H)-thione
Description:
5-[(3-Fluoropropyl)thio]-1,3,4-thiadiazole-2(3H)-thione is a heterocyclic compound characterized by the presence of a thiadiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound features a thioether functional group due to the presence of a propyl chain substituted with a fluorine atom. The thiadiazole moiety contributes to its potential biological activity, as such compounds are often explored for their pharmacological properties. The presence of the fluoropropyl group may enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the thione functional group indicates that the compound may exhibit tautomerism, potentially affecting its reactivity and stability. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry or materials science, although specific biological activities and applications would require further investigation.
Formula:C5H7FN2S3
InChI:InChI=1S/C5H7FN2S3/c6-2-1-3-10-5-8-7-4(9)11-5/h1-3H2,(H,7,9)
InChI key:InChIKey=ONUCYHOUHWGGPL-UHFFFAOYSA-N
SMILES:S(CCCF)C=1SC(=S)NN1
Synonyms:- 1,3,4-Thiadiazole-2(3H)-thione, 5-[(3-fluoropropyl)thio]-
- 5-[(3-Fluoropropyl)thio]-1,3,4-thiadiazole-2(3H)-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.