CAS 866144-14-1
:4,4,5,5,5-Pentafluoro-1-[4-(phenylmethyl)-1-piperazinyl]-1-penten-3-one
Description:
4,4,5,5,5-Pentafluoro-1-[4-(phenylmethyl)-1-piperazinyl]-1-penten-3-one, with CAS number 866144-14-1, is a synthetic organic compound characterized by its complex structure, which includes a pentafluorinated carbon chain and a piperazine moiety. This compound features a conjugated system due to the presence of a double bond in the pentenone structure, contributing to its reactivity and potential applications in medicinal chemistry. The pentafluorination imparts unique electronic properties, enhancing lipophilicity and potentially influencing biological activity. The phenylmethyl group attached to the piperazine ring may enhance interactions with biological targets, making it of interest in drug design. Its fluorinated nature can also affect solubility and stability, which are critical factors in pharmaceutical development. Overall, this compound exemplifies the intersection of fluorine chemistry and medicinal applications, warranting further investigation into its properties and potential uses in therapeutic contexts.
Formula:C16H17F5N2O
InChI:InChI=1S/C16H17F5N2O/c17-15(18,16(19,20)21)14(24)6-7-22-8-10-23(11-9-22)12-13-4-2-1-3-5-13/h1-7H,8-12H2
InChI key:InChIKey=DJIVMJNPYCLHPC-UHFFFAOYSA-N
SMILES:C(N1CCN(C=CC(C(C(F)(F)F)(F)F)=O)CC1)C2=CC=CC=C2
Synonyms:- 4,4,5,5,5-Pentafluoro-1-[4-(phenylmethyl)-1-piperazinyl]-1-penten-3-one
- 1-Penten-3-one, 4,4,5,5,5-pentafluoro-1-[4-(phenylmethyl)-1-piperazinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.