CAS 866144-54-9

β-(1-Ethylpropyl)-1,3-dihydro-1-oxo-2H-isoindole-2-propanoic acid

Description:

β-(1-Ethylpropyl)-1,3-dihydro-1-oxo-2H-isoindole-2-propanoic acid, with the CAS number 866144-54-9, is a chemical compound that belongs to the class of isoindole derivatives. This substance typically exhibits characteristics such as a complex molecular structure, which includes a bicyclic isoindole framework and a propanoic acid moiety. The presence of the ethylpropyl group contributes to its hydrophobic nature, potentially influencing its solubility and interaction with biological systems. The compound may exhibit various biological activities, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties, including its pharmacokinetics, toxicity, and therapeutic potential.

Formula: C₁₆H₂₁NO₃

InChI: InChI=1S/C16H21NO3/c1-3-11(4-2)14(9-15(18)19)17-10-12-7-5-6-8-13(12)16(17)20/h5-8,11,14H,3-4,9-10H2,1-2H3,(H,18,19)

InChI key: InChIKey=ACSPQRZSBZMWMA-UHFFFAOYSA-N

SMILES: C(C(CC)CC)(CC(O)=O)N1C(=O)C=2C(C1)=CC=CC2

Synonyms:

• β-(1-Ethylpropyl)-1,3-dihydro-1-oxo-2H-isoindole-2-propanoic acid
• 2H-Isoindole-2-propanoic acid, β-(1-ethylpropyl)-1,3-dihydro-1-oxo-