CAS 866144-67-4

2-(1,7-Dihydro-5-methyl-7-oxo[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethyl 2-thiophenecarboxylate

Description:

2-(1,7-Dihydro-5-methyl-7-oxo[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethyl 2-thiophenecarboxylate is a chemical compound characterized by its complex structure, which includes a triazolo-pyrimidine moiety and a thiophene carboxylate group. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, including potential biological activity due to its unique functional groups. The presence of the triazole and pyrimidine rings suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the ethyl and thiophene components may contribute to its solubility and reactivity. The compound's molecular structure indicates it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Its specific characteristics, such as melting point, solubility, and spectral properties, would depend on the purity and formulation of the substance. Overall, this compound represents a class of molecules that could have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.

Formula: C₁₃H₁₂N₄O₃S

InChI: InChI=1S/C13H12N4O3S/c1-8-9(11(18)17-13(16-8)14-7-15-17)4-5-20-12(19)10-3-2-6-21-10/h2-3,6-7H,4-5H2,1H3,(H,14,15,16)

InChI key: InChIKey=BQZRXPBIPORXSJ-UHFFFAOYSA-N

SMILES: O=C1N2C(=NC(C)=C1CCOC(=O)C3=CC=CS3)NC=N2

Synonyms:

• 2-(1,7-Dihydro-5-methyl-7-oxo[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethyl 2-thiophenecarboxylate
• 2-Thiophenecarboxylic acid, 2-(1,7-dihydro-5-methyl-7-oxo[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethyl ester