CAS 866145-38-2

2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine

Description:

2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine is a chemical compound characterized by its complex structure, which includes a benzodioxole moiety and an imidazo-pyrimidine framework. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the bromine atom introduces halogenation, which can influence the compound's reactivity and interaction with biological targets. The benzodioxole group is known for its role in various pharmacological activities, while the imidazo-pyrimidine structure is often associated with medicinal chemistry, particularly in the development of pharmaceuticals. This compound may exhibit properties such as fluorescence or specific binding affinities, making it of interest in research and drug development. Its unique structural features suggest potential applications in areas such as cancer therapy or as a biochemical probe, although specific biological activities would require empirical investigation. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₃H₈BrN₃O₂

InChI: InChI=1/C13H8BrN3O2/c14-12-11(16-13-15-4-1-5-17(12)13)8-2-3-9-10(6-8)19-7-18-9/h1-6H,7H2

Synonyms:

• 2-(1,3-Benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine
• imidazo[1,2-a]pyrimidine, 2-(1,3-benzodioxol-5-yl)-3-bromo-
• 2-(1,3-Benzodioxol-5-yl)-3-bromimidazo[1,2-a]pyrimidin

2-(1,3-Benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine

CAS: 866145-38-2

2-(1,3-Benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine

Purity: ≥95%

Ref: 54-OR11717