CAS 866145-72-4
:Methyl 2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyridine-6-carboxylate
Description:
Methyl 2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyridine-6-carboxylate is a chemical compound characterized by its complex structure, which includes a benzodioxole moiety and an imidazo-pyridine framework. This compound features a bromine atom, which contributes to its reactivity and potential biological activity. The presence of the carboxylate group indicates that it can participate in various chemical reactions, such as esterification or nucleophilic substitution. The benzodioxole unit is often associated with pharmacological properties, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, Methyl 2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyridine-6-carboxylate represents a unique scaffold for further exploration in chemical and pharmaceutical research.
Formula:C16H11BrN2O4
InChI:InChI=1S/C16H11BrN2O4/c1-21-16(20)10-3-5-13-18-14(15(17)19(13)7-10)9-2-4-11-12(6-9)23-8-22-11/h2-7H,8H2,1H3
InChI key:InChIKey=VLXVKDAOHHZVGS-UHFFFAOYSA-N
SMILES:BrC1=C(N=C2N1C=C(C(OC)=O)C=C2)C=3C=C4C(=CC3)OCO4
Synonyms:- Methyl 2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyridine-6-carboxylate
- Imidazo[1,2-a]pyridine-6-carboxylic acid, 2-(1,3-benzodioxol-5-yl)-3-bromo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.