CAS 866149-09-9

2,3,4,9-Tetrahydro-2-[[2-(trifluoromethyl)phenyl]methylene]-1H-carbazol-1-one

Description:

2,3,4,9-Tetrahydro-2-[[2-(trifluoromethyl)phenyl]methylene]-1H-carbazol-1-one is a synthetic organic compound characterized by its complex structure, which includes a carbazole moiety and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in pharmaceuticals and materials science. The presence of the trifluoromethyl group enhances lipophilicity and can influence biological activity, making it of interest in medicinal chemistry. The tetrahydro structure indicates that it has a saturated ring system, which may affect its reactivity and stability. Additionally, the compound may exhibit fluorescence due to the conjugated system, which can be useful in various analytical applications. Its unique combination of functional groups and structural features suggests potential for diverse applications, including as a building block in organic synthesis or as a candidate for drug development. However, specific properties such as solubility, melting point, and reactivity would need to be determined through experimental methods.

Formula: C₂₀H₁₄F₃NO

InChI: InChI=1S/C20H14F3NO/c21-20(22,23)16-7-3-1-5-12(16)11-13-9-10-15-14-6-2-4-8-17(14)24-18(15)19(13)25/h1-8,11,24H,9-10H2

InChI key: InChIKey=ODWSLKJDDARPHO-UHFFFAOYSA-N

SMILES: O=C1C2=C(C=3C(N2)=CC=CC3)CCC1=CC4=C(C(F)(F)F)C=CC=C4

Synonyms:

• 1H-Carbazol-1-one, 2,3,4,9-tetrahydro-2-[[2-(trifluoromethyl)phenyl]methylene]-
• 2,3,4,9-Tetrahydro-2-[[2-(trifluoromethyl)phenyl]methylene]-1H-carbazol-1-one