CAS 866149-10-2
:2-[(4-Chlorophenyl)methylene]-2,3,4,9-tetrahydro-1H-carbazol-1-one
Description:
2-[(4-Chlorophenyl)methylene]-2,3,4,9-tetrahydro-1H-carbazol-1-one, with the CAS number 866149-10-2, is a chemical compound characterized by its complex structure, which includes a carbazole moiety and a chlorophenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to its fused ring structure. It is likely to be a solid at room temperature, with potential applications in pharmaceuticals or organic synthesis, given the presence of functional groups that may participate in various chemical reactions. The chlorophenyl substituent can influence its electronic properties, potentially enhancing its reactivity or biological activity. Additionally, the compound may exhibit specific solubility characteristics, depending on the solvent used, and could show interesting interactions in biological systems, making it a candidate for further research in medicinal chemistry. Its stability, reactivity, and potential toxicity would need to be evaluated in detail for practical applications.
Formula:C19H14ClNO
InChI:InChI=1S/C19H14ClNO/c20-14-8-5-12(6-9-14)11-13-7-10-16-15-3-1-2-4-17(15)21-18(16)19(13)22/h1-6,8-9,11,21H,7,10H2
InChI key:InChIKey=DSCZYJKJXQTIBY-UHFFFAOYSA-N
SMILES:O=C1C2=C(C=3C(N2)=CC=CC3)CCC1=CC4=CC=C(Cl)C=C4
Synonyms:- 1H-Carbazol-1-one, 2-[(4-chlorophenyl)methylene]-2,3,4,9-tetrahydro-
- 2-[(4-Chlorophenyl)methylene]-2,3,4,9-tetrahydro-1H-carbazol-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.