CymitQuimica logo

CAS 866149-77-1

:

2-[2-(2-Hydroxyethyl)-1-piperidinyl]-5-[[4-(methylthio)phenyl]methylene]-4(5H)-thiazolone

Description:
The chemical substance known as 2-[2-(2-Hydroxyethyl)-1-piperidinyl]-5-[[4-(methylthio)phenyl]methylene]-4(5H)-thiazolone, with the CAS number 866149-77-1, is characterized by its complex molecular structure, which includes a thiazolone ring, a piperidine moiety, and a phenyl group substituted with a methylthio group. This compound exhibits properties typical of thiazolone derivatives, such as potential biological activity, which may include antimicrobial or anti-inflammatory effects. The presence of the hydroxyethyl and piperidine groups suggests that it may interact with biological systems, potentially serving as a pharmacophore in medicinal chemistry. Additionally, the methylthio substitution on the phenyl ring may influence its lipophilicity and overall reactivity. The compound's solubility, stability, and reactivity would depend on its specific functional groups and the overall molecular conformation. As with many synthetic organic compounds, its applications could span various fields, including pharmaceuticals and agrochemicals, pending further research into its efficacy and safety profiles.
Formula:C18H22N2O2S2
InChI:InChI=1S/C18H22N2O2S2/c1-23-15-7-5-13(6-8-15)12-16-17(22)19-18(24-16)20-10-3-2-4-14(20)9-11-21/h5-8,12,14,21H,2-4,9-11H2,1H3
InChI key:InChIKey=NIYYTBAGZGYGKP-UHFFFAOYSA-N
SMILES:C(CO)C1N(CCCC1)C=2SC(=CC3=CC=C(SC)C=C3)C(=O)N2
Synonyms:
  • 4(5H)-Thiazolone, 2-[2-(2-hydroxyethyl)-1-piperidinyl]-5-[[4-(methylthio)phenyl]methylene]-
  • 2-[2-(2-Hydroxyethyl)-1-piperidinyl]-5-[[4-(methylthio)phenyl]methylene]-4(5H)-thiazolone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.