CAS 866149-83-9
:2-(4-Fluorophenoxy)-1-[6-[1-(4-fluorophenoxy)ethyl]-3-pyridinyl]-1-propanone
Description:
2-(4-Fluorophenoxy)-1-[6-[1-(4-fluorophenoxy)ethyl]-3-pyridinyl]-1-propanone, with CAS number 866149-83-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a propanone backbone, pyridine ring, and multiple fluorophenoxy groups. This compound typically exhibits properties such as moderate to high lipophilicity due to the presence of aromatic fluorine substituents, which can influence its solubility and bioavailability. It may also demonstrate specific biological activities, potentially acting as a pharmacological agent in medicinal chemistry. The presence of the fluorine atoms can enhance metabolic stability and alter the electronic properties of the molecule, affecting its interaction with biological targets. Additionally, the compound's structure suggests potential applications in drug development, particularly in areas targeting specific receptors or enzymes. As with many synthetic compounds, safety and handling precautions are essential, and its behavior in biological systems would require thorough investigation through pharmacological studies.
Formula:C22H19F2NO3
InChI:InChI=1S/C22H19F2NO3/c1-14(27-19-8-4-17(23)5-9-19)21-12-3-16(13-25-21)22(26)15(2)28-20-10-6-18(24)7-11-20/h3-15H,1-2H3
InChI key:InChIKey=UAIBXYCWQNAVSG-UHFFFAOYSA-N
SMILES:C(C(OC1=CC=C(F)C=C1)C)(=O)C=2C=CC(C(OC3=CC=C(F)C=C3)C)=NC2
Synonyms:- 2-(4-Fluorophenoxy)-1-[6-[1-(4-fluorophenoxy)ethyl]-3-pyridinyl]-1-propanone
- 1-Propanone, 2-(4-fluorophenoxy)-1-[6-[1-(4-fluorophenoxy)ethyl]-3-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.