CAS 866150-18-7

N-(2-Fluoro-5-methylphenyl)-N′-methylthiourea

Description:

N-(2-Fluoro-5-methylphenyl)-N′-methylthiourea, identified by its CAS number 866150-18-7, is a chemical compound characterized by the presence of a thiourea functional group, which consists of a carbon atom double-bonded to a sulfur atom and single-bonded to two nitrogen atoms. This compound features a fluoro-substituted aromatic ring, specifically a 2-fluoro-5-methylphenyl group, which contributes to its unique chemical properties and potential biological activity. The presence of the methyl group on the thiourea nitrogen enhances its solubility and reactivity. Generally, thioureas are known for their diverse applications in medicinal chemistry, agrochemicals, and as intermediates in organic synthesis. The fluorine atom in the structure can influence the compound's electronic properties and lipophilicity, potentially affecting its interaction with biological targets. As with many organic compounds, safety and handling precautions should be observed, as the toxicity and environmental impact of this substance may vary based on its specific use and exposure levels.

Formula: C₉H₁₁FN₂S

InChI: InChI=1S/C9H11FN2S/c1-6-3-4-7(10)8(5-6)12-9(13)11-2/h3-5H,1-2H3,(H2,11,12,13)

InChI key: InChIKey=QKEPQQGSSTYJII-UHFFFAOYSA-N

SMILES: N(C(NC)=S)C1=C(F)C=CC(C)=C1

Synonyms:

• N-(2-Fluoro-5-methylphenyl)-N′-methylthiourea
• Thiourea, N-(2-fluoro-5-methylphenyl)-N′-methyl-