
CAS 866150-60-9
:2-[[(2,5-Difluorophenyl)amino]carbonyl]cyclopropanecarboxylic acid
Description:
2-[[(2,5-Difluorophenyl)amino]carbonyl]cyclopropanecarboxylic acid, with the CAS number 866150-60-9, is a chemical compound characterized by its unique structure that includes a cyclopropane ring, an amide functional group, and a carboxylic acid. This compound features a difluorophenyl group, which contributes to its potential biological activity and lipophilicity. The presence of the cyclopropane moiety may impart strain and influence the compound's reactivity and stability. As an acid, it can participate in various chemical reactions, including esterification and amidation. The difluorophenyl substituent may enhance the compound's interaction with biological targets, making it of interest in medicinal chemistry. Its specific properties, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or agrochemicals, warranting further investigation into its biological and chemical behavior.
Formula:C11H9F2NO3
InChI:InChI=1S/C11H9F2NO3/c12-5-1-2-8(13)9(3-5)14-10(15)6-4-7(6)11(16)17/h1-3,6-7H,4H2,(H,14,15)(H,16,17)
InChI key:InChIKey=QTWGHTBKFVANGX-UHFFFAOYSA-N
SMILES:C(NC1=C(F)C=CC(F)=C1)(=O)C2C(C(O)=O)C2
Synonyms:- 2-[[(2,5-Difluorophenyl)amino]carbonyl]cyclopropanecarboxylic acid
- Cyclopropanecarboxylic acid, 2-[[(2,5-difluorophenyl)amino]carbonyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.