CAS 866152-24-1
:3-[(2,6-Dichlorobenzoyl)amino]-4-methyl-2-thiophenecarboxylic acid
Description:
3-[(2,6-Dichlorobenzoyl)amino]-4-methyl-2-thiophenecarboxylic acid, identified by its CAS number 866152-24-1, is a synthetic organic compound characterized by its complex structure that includes a thiophene ring, an amine group, and a carboxylic acid functional group. This compound features a dichlorobenzoyl moiety, which contributes to its potential biological activity and chemical reactivity. The presence of the thiophene ring suggests that it may exhibit unique electronic properties and interactions, making it of interest in pharmaceutical and agrochemical research. The dichlorobenzoyl group may enhance lipophilicity, influencing the compound's solubility and permeability. Additionally, the carboxylic acid group can participate in hydrogen bonding and ionic interactions, which may affect its behavior in biological systems. Overall, this compound's structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. However, specific biological activity and toxicity profiles would require further investigation through empirical studies.
Formula:C13H9Cl2NO3S
InChI:InChI=1S/C13H9Cl2NO3S/c1-6-5-20-11(13(18)19)10(6)16-12(17)9-7(14)3-2-4-8(9)15/h2-5H,1H3,(H,16,17)(H,18,19)
InChI key:InChIKey=FHFOOAWVOZGCQT-UHFFFAOYSA-N
SMILES:N(C(=O)C1=C(Cl)C=CC=C1Cl)C2=C(C(O)=O)SC=C2C
Synonyms:- 2-Thiophenecarboxylic acid, 3-[(2,6-dichlorobenzoyl)amino]-4-methyl-
- 3-[(2,6-Dichlorobenzoyl)amino]-4-methyl-2-thiophenecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.