
CAS 866154-61-2
:N-Acetyl-N-[5-(1,3-benzodioxol-5-ylmethylene)-4-oxo-2-thioxo-3-thiazolidinyl]acetamide
Description:
N-Acetyl-N-[5-(1,3-benzodioxol-5-ylmethylene)-4-oxo-2-thioxo-3-thiazolidinyl]acetamide, with CAS number 866154-61-2, is a synthetic organic compound characterized by its complex structure, which includes a thiazolidinone ring and a benzodioxole moiety. This compound typically exhibits properties associated with thiazolidinones, such as potential biological activity, including antimicrobial and anti-inflammatory effects. The presence of the acetyl group suggests it may participate in various chemical reactions, including acylation. Its unique structure may contribute to its solubility and reactivity, making it of interest in medicinal chemistry and drug development. The compound's molecular interactions can be influenced by the functional groups present, which may affect its pharmacokinetic and pharmacodynamic properties. As with many synthetic compounds, understanding its stability, reactivity, and biological interactions is crucial for potential applications in pharmaceuticals or agrochemicals. Further studies would be necessary to elucidate its full range of characteristics and potential uses.
Formula:C15H12N2O5S2
InChI:InChI=1S/C15H12N2O5S2/c1-8(18)16(9(2)19)17-14(20)13(24-15(17)23)6-10-3-4-11-12(5-10)22-7-21-11/h3-6H,7H2,1-2H3
InChI key:InChIKey=ADGBFIPVJBPVOM-UHFFFAOYSA-N
SMILES:N(C(C)=O)(C(C)=O)N1C(=O)C(=CC=2C=C3C(=CC2)OCO3)SC1=S
Synonyms:- N-Acetyl-N-[5-(1,3-benzodioxol-5-ylmethylene)-4-oxo-2-thioxo-3-thiazolidinyl]acetamide
- Acetamide, N-acetyl-N-[5-(1,3-benzodioxol-5-ylmethylene)-4-oxo-2-thioxo-3-thiazolidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.