CAS 866154-66-7
:N-[(3,4-Difluorophenyl)methyl]-3-nitro-2-pyridinamine
Description:
N-[(3,4-Difluorophenyl)methyl]-3-nitro-2-pyridinamine is a chemical compound characterized by its unique molecular structure, which includes a pyridine ring substituted with a nitro group and a side chain featuring a difluorophenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the nitro group suggests it may participate in electrophilic reactions, while the difluorophenyl group can influence its lipophilicity and interaction with biological targets. The compound's molecular formula and structure contribute to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the specific arrangement of functional groups may affect its reactivity, stability, and overall pharmacokinetic properties. As with many compounds in this class, safety and handling precautions are essential due to the presence of potentially hazardous functional groups.
Formula:C12H9F2N3O2
InChI:InChI=1S/C12H9F2N3O2/c13-9-4-3-8(6-10(9)14)7-16-12-11(17(18)19)2-1-5-15-12/h1-6H,7H2,(H,15,16)
InChI key:InChIKey=XUFKYAWDLPJBTL-UHFFFAOYSA-N
SMILES:N(CC1=CC(F)=C(F)C=C1)C2=C(N(=O)=O)C=CC=N2
Synonyms:- 2-Pyridinamine, N-[(3,4-difluorophenyl)methyl]-3-nitro-
- N-[(3,4-Difluorophenyl)methyl]-3-nitro-2-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.