
CAS 866154-85-0
:4-[(4,6-Dimethoxy-2-pyrimidinyl)oxy]-2-methylbenzenamine
Description:
4-[(4,6-Dimethoxy-2-pyrimidinyl)oxy]-2-methylbenzenamine, with the CAS number 866154-85-0, is an organic compound characterized by its complex structure, which includes a pyrimidine ring and an amine group. This substance features a methoxy-substituted pyrimidine moiety, contributing to its potential biological activity. The presence of the amine group suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. The compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic and hydrophilic functional groups. Its molecular structure may allow for interactions with various biological targets, making it of interest in medicinal chemistry. Additionally, the methoxy groups can enhance lipophilicity and influence pharmacokinetic properties. As with many organic compounds, its stability, reactivity, and potential applications would depend on environmental conditions such as pH and temperature. Overall, this compound's unique features position it as a candidate for further research in drug development or other chemical applications.
Formula:C13H15N3O3
InChI:InChI=1S/C13H15N3O3/c1-8-6-9(4-5-10(8)14)19-13-15-11(17-2)7-12(16-13)18-3/h4-7H,14H2,1-3H3
InChI key:InChIKey=OJYVXGANKKXYJA-UHFFFAOYSA-N
SMILES:O(C=1N=C(OC)C=C(OC)N1)C2=CC(C)=C(N)C=C2
Synonyms:- Benzenamine, 4-[(4,6-dimethoxy-2-pyrimidinyl)oxy]-2-methyl-
- 4-[(4,6-Dimethoxy-2-pyrimidinyl)oxy]-2-methylbenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.