
CAS 866155-62-6
:2-Methyl-6-[(4-phenyl-1-piperidinyl)methyl]-4(3H)-pyrimidinone
Description:
2-Methyl-6-[(4-phenyl-1-piperidinyl)methyl]-4(3H)-pyrimidinone, identified by its CAS number 866155-62-6, is a synthetic organic compound characterized by its pyrimidinone core structure, which is substituted at various positions. The presence of a methyl group at the 2-position and a piperidine ring attached to a phenyl group at the 6-position contributes to its unique chemical properties. This compound typically exhibits moderate to high lipophilicity due to the aromatic and aliphatic components, which can influence its solubility and permeability in biological systems. It may also demonstrate potential pharmacological activity, making it of interest in medicinal chemistry. The molecular structure suggests that it could interact with various biological targets, potentially leading to applications in therapeutic contexts. As with many organic compounds, its stability, reactivity, and interactions with other substances would depend on environmental conditions such as pH, temperature, and the presence of solvents or other reagents.
Formula:C17H21N3O
InChI:InChI=1S/C17H21N3O/c1-13-18-16(11-17(21)19-13)12-20-9-7-15(8-10-20)14-5-3-2-4-6-14/h2-6,11,15H,7-10,12H2,1H3,(H,18,19,21)
InChI key:InChIKey=QEOPQOKSEATYPU-UHFFFAOYSA-N
SMILES:C(C1=CC(=O)N=C(C)N1)N2CCC(CC2)C3=CC=CC=C3
Synonyms:- 2-Methyl-6-[(4-phenyl-1-piperidinyl)methyl]-4(3H)-pyrimidinone
- 4(1H)-Pyrimidinone, 2-methyl-6-[(4-phenyl-1-piperidinyl)methyl]-
- 4(3H)-Pyrimidinone, 2-methyl-6-[(4-phenyl-1-piperidinyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.