CAS 866155-88-6

4-[[(2-Thienylmethyl)imino]methyl]phenol

Description:

4-[[(2-Thienylmethyl)imino]methyl]phenol, with the CAS number 866155-88-6, is an organic compound characterized by its unique structure that includes a phenolic group and a thienylmethyl imine moiety. This compound typically exhibits properties associated with both phenols and imines, such as potential antioxidant activity and the ability to participate in various chemical reactions due to the presence of the imine functional group. The thienyl ring contributes to its aromatic character and may influence its solubility and reactivity. In terms of physical properties, compounds of this nature may be expected to have moderate to high melting points and solubility in polar solvents, depending on the specific substituents and their interactions. Additionally, the presence of the imine linkage suggests potential applications in coordination chemistry or as a ligand in metal complexes. Overall, 4-[[(2-Thienylmethyl)imino]methyl]phenol represents a class of compounds that may have diverse applications in pharmaceuticals, materials science, and organic synthesis.

Formula: C₁₂H₁₁NOS

InChI: InChI=1S/C12H11NOS/c14-11-5-3-10(4-6-11)8-13-9-12-2-1-7-15-12/h1-8,14H,9H2

InChI key: InChIKey=BECGSTYPRQEETG-UHFFFAOYSA-N

SMILES: C(=NCC1=CC=CS1)C2=CC=C(O)C=C2

Synonyms:

• 4-[[(2-Thienylmethyl)imino]methyl]phenol
• Phenol, 4-[[(2-thienylmethyl)imino]methyl]-