CAS 866156-41-4
:2-Cyano-3-(4-ethoxyphenyl)-N-[4-(trifluoromethyl)phenyl]-2-propenamide
Description:
2-Cyano-3-(4-ethoxyphenyl)-N-[4-(trifluoromethyl)phenyl]-2-propenamide, identified by its CAS number 866156-41-4, is an organic compound characterized by its complex structure, which includes a cyano group, an ethoxy-substituted phenyl group, and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with amides, such as moderate solubility in organic solvents and potential reactivity due to the presence of the cyano and amide functional groups. The trifluoromethyl group often imparts unique electronic properties, enhancing the compound's lipophilicity and potentially influencing its biological activity. The ethoxy group can also affect solubility and reactivity. Overall, this compound may be of interest in pharmaceutical research and development due to its structural features, which could contribute to specific interactions with biological targets. Its synthesis and characterization would involve standard organic chemistry techniques, and its applications could range from medicinal chemistry to materials science, depending on its specific properties and reactivity.
Formula:C19H15F3N2O2
InChI:InChI=1S/C19H15F3N2O2/c1-2-26-17-9-3-13(4-10-17)11-14(12-23)18(25)24-16-7-5-15(6-8-16)19(20,21)22/h3-11H,2H2,1H3,(H,24,25)
InChI key:InChIKey=SHHLXVUNCXHXSY-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC=C(NC(C(=CC2=CC=C(OCC)C=C2)C#N)=O)C=C1
Synonyms:- 2-Cyano-3-(4-ethoxyphenyl)-N-[4-(trifluoromethyl)phenyl]-2-propenamide
- 2-Propenamide, 2-cyano-3-(4-ethoxyphenyl)-N-[4-(trifluoromethyl)phenyl]-
- (E)-2-cyano-3-(4-ethoxyphenyl)-N-[4-(trifluoromethyl)phenyl]-2-propenamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.