CAS 866156-88-9

2-(Methyl-2-pyrazinylamino)ethanol

Description:

2-(Methyl-2-pyrazinylamino)ethanol, with the CAS number 866156-88-9, is an organic compound characterized by its unique structure that includes a pyrazine ring and an amino alcohol functional group. This compound typically exhibits properties such as being a solid or liquid at room temperature, depending on its specific formulation and purity. It is likely to be soluble in polar solvents due to the presence of the hydroxyl (-OH) group, which enhances its ability to interact with water and other polar substances. The pyrazine moiety may contribute to its biological activity, potentially making it of interest in pharmaceutical applications. Additionally, the presence of the methyl group can influence its steric and electronic properties, affecting its reactivity and interactions with other molecules. Overall, 2-(Methyl-2-pyrazinylamino)ethanol is a compound that may have diverse applications in medicinal chemistry and related fields, although specific data on its biological activity and toxicity would require further investigation.

Formula: C₇H₁₁N₃O

InChI: InChI=1S/C7H11N3O/c1-10(4-5-11)7-6-8-2-3-9-7/h2-3,6,11H,4-5H2,1H3

InChI key: InChIKey=YMYFEMWFUHHFCL-UHFFFAOYSA-N

SMILES: N(CCO)(C)C=1C=NC=CN1

Synonyms:

• 2-(Methyl-2-pyrazinylamino)ethanol
• Ethanol, 2-(methyl-2-pyrazinylamino)-
• Ethanol, 2-(methylpyrazinylamino)-