
CAS 866157-03-1
:N-[3-(2-Pyrazinyloxy)phenyl]-N′-[3-(trifluoromethyl)phenyl]urea
Description:
N-[3-(2-Pyrazinyloxy)phenyl]-N′-[3-(trifluoromethyl)phenyl]urea, identified by its CAS number 866157-03-1, is a chemical compound characterized by its unique structural features, which include a urea functional group linked to two distinct aromatic moieties. The presence of a pyrazine ring contributes to its potential biological activity, while the trifluoromethyl group enhances lipophilicity and may influence its pharmacokinetic properties. This compound is typically studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its molecular structure suggests it may exhibit interesting interactions with biological targets, making it a candidate for further research in drug discovery. Additionally, the presence of fluorine atoms often correlates with increased metabolic stability and bioactivity. As with many compounds in this class, understanding its solubility, stability, and reactivity under various conditions is crucial for evaluating its practical applications in research and industry.
Formula:C18H13F3N4O2
InChI:InChI=1S/C18H13F3N4O2/c19-18(20,21)12-3-1-4-13(9-12)24-17(26)25-14-5-2-6-15(10-14)27-16-11-22-7-8-23-16/h1-11H,(H2,24,25,26)
InChI key:InChIKey=BTIJRMWCGCCZCL-UHFFFAOYSA-N
SMILES:O(C1=CC(NC(NC2=CC(C(F)(F)F)=CC=C2)=O)=CC=C1)C=3C=NC=CN3
Synonyms:- N-[3-(2-Pyrazinyloxy)phenyl]-N′-[3-(trifluoromethyl)phenyl]urea
- Urea, N-[3-(pyrazinyloxy)phenyl]-N′-[3-(trifluoromethyl)phenyl]-
- Urea, N-[3-(2-pyrazinyloxy)phenyl]-N′-[3-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.