CAS 86621-94-5
:4-[2-[4-[(E)-3-(4-chlorophenyl)allyl]piperazin-1-yl]ethyl]benzoic acid; sulfuric acid
Description:
The chemical substance known as 4-[2-[4-[(E)-3-(4-chlorophenyl)allyl]piperazin-1-yl]ethyl]benzoic acid, with the CAS number 86621-94-5, is a complex organic compound characterized by its multi-functional structure. It features a benzoic acid moiety, which contributes to its acidic properties, and a piperazine ring that is often associated with pharmacological activity. The presence of a chlorophenyl group and an allyl substituent suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound may exhibit various solubility characteristics depending on the pH of the environment due to the carboxylic acid group. Additionally, the presence of sulfuric acid in its formulation indicates that it may be used in specific synthetic processes or as a catalyst. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of therapeutic agents targeting neurological or psychiatric conditions. However, detailed studies would be necessary to fully elucidate its properties and biological activities.
Formula:C22H27ClN2O6S
InChI:InChI=1/C22H25ClN2O2.H2O4S/c23-21-9-5-18(6-10-21)2-1-12-24-14-16-25(17-15-24)13-11-19-3-7-20(8-4-19)22(26)27;1-5(2,3)4/h1-10H,11-17H2,(H,26,27);(H2,1,2,3,4)/b2-1+;
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
BM 15766 sulfate
CAS:BM 15766 sulfate, an inhibitor of 7-dehydrocholesterol δ7-reductase, effectively reduces plasma cholesterol levels and functions as a hypolipidemic agent [1] [2Formula:C22H27ClN2O6SColor and Shape:SolidMolecular weight:482.98

