CAS 866211-12-3

7-fluoro-3-methyl-1H-indole-2-carboxylic acid

Description:

7-Fluoro-3-methyl-1H-indole-2-carboxylic acid is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a fluoro group at the 7-position and a methyl group at the 3-position contributes to its unique chemical properties. As a carboxylic acid, it features a carboxyl functional group (-COOH) that imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. This compound is of interest in medicinal chemistry and pharmaceutical research due to its potential biological activities, including antimicrobial and anti-inflammatory properties. Its molecular structure allows for interactions with biological targets, making it a candidate for drug development. Additionally, the presence of the fluorine atom can enhance lipophilicity and metabolic stability, which are desirable traits in drug design. Overall, 7-fluoro-3-methyl-1H-indole-2-carboxylic acid exemplifies the complexity and versatility of indole derivatives in chemical and biological applications.

Formula: C₁₀H₈FNO₂

InChI: InChI=1/C10H8FNO2/c1-5-6-3-2-4-7(11)9(6)12-8(5)10(13)14/h2-4,12H,1H3,(H,13,14)

SMILES: Cc1c2cccc(c2[nH]c1C(=O)O)F