CAS 866318-99-2

5-fluoro-1-(p-tolylsulfonyl)pyrrolo[2,3-b]pyridine

Description:

5-Fluoro-1-(p-tolylsulfonyl)pyrrolo[2,3-b]pyridine is a chemical compound characterized by its unique structure, which includes a pyrrolo[2,3-b]pyridine core substituted with a fluorine atom and a p-tolylsulfonyl group. This compound typically exhibits properties such as moderate to high solubility in organic solvents, which is common for many heterocyclic compounds. The presence of the sulfonyl group enhances its reactivity and potential for forming various derivatives. It may also demonstrate biological activity, making it of interest in pharmaceutical research, particularly in the development of targeted therapies. The fluorine substitution can influence the compound's electronic properties, potentially affecting its interaction with biological targets. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 5-fluoro-1-(p-tolylsulfonyl)pyrrolo[2,3-b]pyridine represents a class of compounds that are valuable in medicinal chemistry and material science due to their diverse functional properties.

Formula: C₁₄H₁₁FN₂O₂S

InChI: InChI=1/C14H11FN2O2S/c1-10-2-4-13(5-3-10)20(18,19)17-7-6-11-8-12(15)9-16-14(11)17/h2-9H,1H3

SMILES: Cc1ccc(cc1)S(=O)(=O)n1ccc2cc(cnc12)F