CAS 866319-00-8

5-FLUORO-1H-PYRROLO[2,3-B]PYRIDINE

Description:

5-Fluoro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a fluorine atom at the 5-position enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. This compound typically exhibits a planar structure, which can facilitate interactions with biological targets. Its molecular framework allows for potential applications in drug development, particularly in the design of pharmaceuticals targeting various diseases. The compound is likely to be soluble in organic solvents, and its reactivity may be influenced by the electron-withdrawing nature of the fluorine substituent. Additionally, it may undergo various chemical reactions, such as nucleophilic substitutions or electrophilic additions, depending on the conditions. Overall, 5-fluoro-1H-pyrrolo[2,3-b]pyridine represents a valuable scaffold in the synthesis of novel compounds with potential therapeutic applications.

Formula: C₇H₅FN₂

InChI: InChI=1/C7H5FN2/c8-6-3-5-1-2-9-7(5)10-4-6/h1-4H,(H,9,10)

SMILES: c1cnc2c1cc(c[nH]2)F

Synonyms:

• 5-Fluoro-7-Azaindole

5-FLUORO-1H-PYRROLO[2,3-B]PYRIDINE

CAS: 866319-00-8

Formula: C₇H₅FN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 136.1264

Ref: IN-DA0036DE

5-Fluoro-7-azaindole

CAS: 866319-00-8

5-Fluoro-7-azaindole

Formula: C₇H₅FN₂

Purity: 97%

Color and Shape: orange/brown crystalline solid

Molecular weight: 136.13g/mol

Ref: 54-PC200049

5-Fluoro-1H-pyrrolo[2,3-b]pyridine

CAS: 866319-00-8

Formula: C₇H₅FN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 136.129

Ref: 10-F076922